C82H81N — CID 177066973
N-[9,9-bis(4-tert-butylphenyl)fluoren-2-yl]-2,7,7'-tritert-butyl-N-(3-phenylphenyl)-9,9'-spirobi[fluorene]-2'-amine (PubChem CID 177066973) has the molecular formula C82H81N and a molecular weight of 1080.56 g/mol. Its IUPAC name is N-[9,9-bis(4-tert-butylphenyl)fluoren-2-yl]-2,7,7'-tritert-butyl-N-(3-phenylphenyl)-9,9'-spirobi[fluorene]-2'-amine.
| Compound Name | N-[9,9-bis(4-tert-butylphenyl)fluoren-2-yl]-2,7,7'-tritert-butyl-N-(3-phenylphenyl)-9,9'-spirobi[fluorene]-2'-amine |
|---|---|
| PubChem CID | 177066973 |
| Molecular Formula | C82H81N |
| Molecular Weight | 1080.56 g/mol |
| Exact Mass | 1079.64 |
| IUPAC Name | N-[9,9-bis(4-tert-butylphenyl)fluoren-2-yl]-2,7,7'-tritert-butyl-N-(3-phenylphenyl)-9,9'-spirobi[fluorene]-2'-amine |
| SMILES | CC(C)(C)c1ccc(C2(c3ccc(C(C)(C)C)cc3)c3ccccc3-c3ccc(N(c4cccc(-c5ccccc5)c4)c4ccc5c(c4)C4(c6cc(C(C)(C)C)ccc6-5)c5cc(C(C)(C)C)ccc5-c5ccc(C(C)(C)C)cc54)cc32)cc1 |
| InChI | InChI=1S/C82H81N/c1-76(2,3)54-28-32-56(33-29-54)81(57-34-30-55(31-35-57)77(4,5)6)70-27-20-19-26-64(70)68-44-39-62(50-74(68)81)83(61-25-21-24-53(46-61)52-22-17-16-18-23-52)63-40-45-69-67-43-38-60(80(13,14)15)49-73(67)82(75(69)51-63)71-47-58(78(7,8)9)36-41-65(71)66-42-37-59(48-72(66)82)79(10,11)12/h16-51H,1-15H3 |
| InChIKey | OBEOKBRKFNXMCN-UHFFFAOYSA-N |
| XLogP | 22.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1080.56 |
| LogP ≤ 5 | 22.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |