C78H75N — CID 177067356
N-[4-(1-adamantyl)phenyl]-3,6-ditert-butyl-N-[9-(4-tert-butylphenyl)-9-phenylfluoren-2-yl]-9,9'-spirobi[fluorene]-2'-amine (PubChem CID 177067356) has the molecular formula C78H75N and a molecular weight of 1026.46 g/mol. Its IUPAC name is N-[4-(1-adamantyl)phenyl]-3,6-ditert-butyl-N-[9-(4-tert-butylphenyl)-9-phenylfluoren-2-yl]-9,9'-spirobi[fluorene]-2'-amine.
| Compound Name | N-[4-(1-adamantyl)phenyl]-3,6-ditert-butyl-N-[9-(4-tert-butylphenyl)-9-phenylfluoren-2-yl]-9,9'-spirobi[fluorene]-2'-amine |
|---|---|
| PubChem CID | 177067356 |
| Molecular Formula | C78H75N |
| Molecular Weight | 1026.46 g/mol |
| Exact Mass | 1025.59 |
| IUPAC Name | N-[4-(1-adamantyl)phenyl]-3,6-ditert-butyl-N-[9-(4-tert-butylphenyl)-9-phenylfluoren-2-yl]-9,9'-spirobi[fluorene]-2'-amine |
| SMILES | CC(C)(C)c1ccc(C2(c3ccccc3)c3ccccc3-c3ccc(N(c4ccc(C56CC7CC(CC(C7)C5)C6)cc4)c4ccc5c(c4)C4(c6ccccc6-5)c5ccc(C(C)(C)C)cc5-c5cc(C(C)(C)C)ccc54)cc32)cc1 |
| InChI | InChI=1S/C78H75N/c1-73(2,3)52-23-25-55(26-24-52)77(54-17-11-10-12-18-54)67-21-15-13-19-61(67)63-35-33-59(44-71(63)77)79(58-31-27-53(28-32-58)76-46-49-39-50(47-76)41-51(40-49)48-76)60-34-36-64-62-20-14-16-22-68(62)78(72(64)45-60)69-37-29-56(74(4,5)6)42-65(69)66-43-57(75(7,8)9)30-38-70(66)78/h10-38,42-45,49-51H,39-41,46-48H2,1-9H3 |
| InChIKey | RCKZNLFXRQHLRJ-UHFFFAOYSA-N |
| XLogP | 20.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1026.46 |
| LogP ≤ 5 | 20.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |