C54H58O2 — CID 11767814
2,7-ditert-butyl-9-[4-[4-(2,7-ditert-butyl-9-hydroxyfluoren-9-yl)phenyl]phenyl]fluoren-9-ol (PubChem CID 11767814) has the molecular formula C54H58O2 and a molecular weight of 739.06 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-[4-[4-(2,7-ditert-butyl-9-hydroxyfluoren-9-yl)phenyl]phenyl]fluoren-9-ol.
| Compound Name | 2,7-ditert-butyl-9-[4-[4-(2,7-ditert-butyl-9-hydroxyfluoren-9-yl)phenyl]phenyl]fluoren-9-ol |
|---|---|
| PubChem CID | 11767814 |
| Molecular Formula | C54H58O2 |
| Molecular Weight | 739.06 g/mol |
| Exact Mass | 738.44 |
| IUPAC Name | 2,7-ditert-butyl-9-[4-[4-(2,7-ditert-butyl-9-hydroxyfluoren-9-yl)phenyl]phenyl]fluoren-9-ol |
| SMILES | CC(C)(C)c1ccc2c(c1)C(O)(c1ccc(-c3ccc(C4(O)c5cc(C(C)(C)C)ccc5-c5ccc(C(C)(C)C)cc54)cc3)cc1)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C54H58O2/c1-49(2,3)37-21-25-41-42-26-22-38(50(4,5)6)30-46(42)53(55,45(41)29-37)35-17-13-33(14-18-35)34-15-19-36(20-16-34)54(56)47-31-39(51(7,8)9)23-27-43(47)44-28-24-40(32-48(44)54)52(10,11)12/h13-32,55-56H,1-12H3 |
| InChIKey | BLVNVLHOBHONPH-UHFFFAOYSA-N |
| XLogP | 13.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.06 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |