C35H39N — CID 172803481
1-[4-(3,5-ditert-butylphenyl)phenyl]-9,9-dimethylfluoren-2-amine (PubChem CID 172803481) has the molecular formula C35H39N and a molecular weight of 473.70 g/mol. Its IUPAC name is 1-[4-(3,5-ditert-butylphenyl)phenyl]-9,9-dimethylfluoren-2-amine.
| Compound Name | 1-[4-(3,5-ditert-butylphenyl)phenyl]-9,9-dimethylfluoren-2-amine |
|---|---|
| PubChem CID | 172803481 |
| Molecular Formula | C35H39N |
| Molecular Weight | 473.70 g/mol |
| Exact Mass | 473.31 |
| IUPAC Name | 1-[4-(3,5-ditert-butylphenyl)phenyl]-9,9-dimethylfluoren-2-amine |
| SMILES | CC(C)(C)c1cc(-c2ccc(-c3c(N)ccc4c3C(C)(C)c3ccccc3-4)cc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C35H39N/c1-33(2,3)25-19-24(20-26(21-25)34(4,5)6)22-13-15-23(16-14-22)31-30(36)18-17-28-27-11-9-10-12-29(27)35(7,8)32(28)31/h9-21H,36H2,1-8H3 |
| InChIKey | REMFEEPUPXEKGY-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.70 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|