C27H41N — CID 144696591
3-[1-[(Z)-but-2-enyl]-2-ethenyl-3-[(Z)-prop-1-enyl]inden-1-yl]-N-methylbutan-2-amine;ethane;ethene (PubChem CID 144696591) has the molecular formula C27H41N and a molecular weight of 379.63 g/mol. Its IUPAC name is 3-[1-[(Z)-but-2-enyl]-2-ethenyl-3-[(Z)-prop-1-enyl]inden-1-yl]-N-methylbutan-2-amine;ethane;ethene.
| Compound Name | 3-[1-[(Z)-but-2-enyl]-2-ethenyl-3-[(Z)-prop-1-enyl]inden-1-yl]-N-methylbutan-2-amine;ethane;ethene |
|---|---|
| PubChem CID | 144696591 |
| Molecular Formula | C27H41N |
| Molecular Weight | 379.63 g/mol |
| Exact Mass | 379.32 |
| IUPAC Name | 3-[1-[(Z)-but-2-enyl]-2-ethenyl-3-[(Z)-prop-1-enyl]inden-1-yl]-N-methylbutan-2-amine;ethane;ethene |
| SMILES | C=C.C=CC1=C(/C=C\C)c2ccccc2C1(C/C=C\C)C(C)C(C)NC.CC |
| InChI | InChI=1S/C23H31N.C2H6.C2H4/c1-7-10-16-23(17(4)18(5)24-6)21(9-3)19(13-8-2)20-14-11-12-15-22(20)23;2*1-2/h7-15,17-18,24H,3,16H2,1-2,4-6H3;1-2H3;1-2H2/b10-7-,13-8-;; |
| InChIKey | QUEDRUQMLIRMLR-PJZMCVJASA-N |
| XLogP | 7.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.63 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|