C30H50 — CID 144803694
but-2-ene;ethane;2-ethenyl-3-methyl-1-pentan-2-yl-1-pent-4-enylindene (PubChem CID 144803694) has the molecular formula C30H50 and a molecular weight of 410.73 g/mol. Its IUPAC name is but-2-ene;ethane;2-ethenyl-3-methyl-1-pentan-2-yl-1-pent-4-enylindene.
| Compound Name | but-2-ene;ethane;2-ethenyl-3-methyl-1-pentan-2-yl-1-pent-4-enylindene |
|---|---|
| PubChem CID | 144803694 |
| Molecular Formula | C30H50 |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 410.39 |
| IUPAC Name | but-2-ene;ethane;2-ethenyl-3-methyl-1-pentan-2-yl-1-pent-4-enylindene |
| SMILES | C=CCCCC1(C(C)CCC)C(C=C)=C(C)c2ccccc21.CC.CC.CC=CC |
| InChI | InChI=1S/C22H30.C4H8.2C2H6/c1-6-9-12-16-22(17(4)13-7-2)20(8-3)18(5)19-14-10-11-15-21(19)22;1-3-4-2;2*1-2/h6,8,10-11,14-15,17H,1,3,7,9,12-13,16H2,2,4-5H3;3-4H,1-2H3;2*1-2H3 |
| InChIKey | YGVONDKBYAZNLW-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|