C20H17N — CID 143038959
2-[(1Z)-buta-1,3-dienyl]-3-methyl-N-phenylinden-1-imine (PubChem CID 143038959) has the molecular formula C20H17N and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-3-methyl-N-phenylinden-1-imine.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-3-methyl-N-phenylinden-1-imine |
|---|---|
| PubChem CID | 143038959 |
| Molecular Formula | C20H17N |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-3-methyl-N-phenylinden-1-imine |
| SMILES | C=C/C=C\C1=C(C)c2ccccc2/C1=N\c1ccccc1 |
| InChI | InChI=1S/C20H17N/c1-3-4-12-18-15(2)17-13-8-9-14-19(17)20(18)21-16-10-6-5-7-11-16/h3-14H,1H2,2H3/b12-4-,21-20- |
| InChIKey | AOQLQNXIYKHIQZ-MLMBZIEJSA-N |
| XLogP | 5.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|