C28H22N2O2 — CID 10341955
1,4-dimethoxy-9-N,10-N-diphenylanthracene-9,10-diimine (PubChem CID 10341955) has the molecular formula C28H22N2O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 1,4-dimethoxy-9-N,10-N-diphenylanthracene-9,10-diimine.
| Compound Name | 1,4-dimethoxy-9-N,10-N-diphenylanthracene-9,10-diimine |
|---|---|
| PubChem CID | 10341955 |
| Molecular Formula | C28H22N2O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 1,4-dimethoxy-9-N,10-N-diphenylanthracene-9,10-diimine |
| SMILES | COc1ccc(OC)c2c1/C(=N/c1ccccc1)c1ccccc1/C2=N\c1ccccc1 |
| InChI | InChI=1S/C28H22N2O2/c1-31-23-17-18-24(32-2)26-25(23)27(29-19-11-5-3-6-12-19)21-15-9-10-16-22(21)28(26)30-20-13-7-4-8-14-20/h3-18H,1-2H3/b29-27+,30-28+ |
| InChIKey | PJHNKDSEXZGZPD-QAVVBOBSSA-N |
| XLogP | 6.36 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|