C21H19IO3 — CID 175345189
2-(2-iodophenyl)-1,4-dimethoxy-3-(2-methoxyphenyl)benzene (PubChem CID 175345189) has the molecular formula C21H19IO3 and a molecular weight of 446.28 g/mol. Its IUPAC name is 2-(2-iodophenyl)-1,4-dimethoxy-3-(2-methoxyphenyl)benzene.
| Compound Name | 2-(2-iodophenyl)-1,4-dimethoxy-3-(2-methoxyphenyl)benzene |
|---|---|
| PubChem CID | 175345189 |
| Molecular Formula | C21H19IO3 |
| Molecular Weight | 446.28 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 2-(2-iodophenyl)-1,4-dimethoxy-3-(2-methoxyphenyl)benzene |
| SMILES | COc1ccccc1-c1c(OC)ccc(OC)c1-c1ccccc1I |
| InChI | InChI=1S/C21H19IO3/c1-23-17-11-7-5-9-15(17)21-19(25-3)13-12-18(24-2)20(21)14-8-4-6-10-16(14)22/h4-13H,1-3H3 |
| InChIKey | XRLJNNHVPAMAJM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.28 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|