C10H8INO2 — CID 53254672
4-iodo-3-(2-methoxyphenyl)-1,2-oxazole (PubChem CID 53254672) has the molecular formula C10H8INO2 and a molecular weight of 301.08 g/mol. Its IUPAC name is 4-iodo-3-(2-methoxyphenyl)-1,2-oxazole.
| Compound Name | 4-iodo-3-(2-methoxyphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 53254672 |
| Molecular Formula | C10H8INO2 |
| Molecular Weight | 301.08 g/mol |
| Exact Mass | 300.96 |
| IUPAC Name | 4-iodo-3-(2-methoxyphenyl)-1,2-oxazole |
| SMILES | COc1ccccc1-c1nocc1I |
| InChI | InChI=1S/C10H8INO2/c1-13-9-5-3-2-4-7(9)10-8(11)6-14-12-10/h2-6H,1H3 |
| InChIKey | RDZNLLUZEIPAQU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.08 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|