C35H31IO4 — CID 145152049
1-iodo-2,3,5,6-tetrakis(2-methoxyphenyl)-4-methylbenzene (PubChem CID 145152049) has the molecular formula C35H31IO4 and a molecular weight of 642.53 g/mol. Its IUPAC name is 1-iodo-2,3,5,6-tetrakis(2-methoxyphenyl)-4-methylbenzene.
| Compound Name | 1-iodo-2,3,5,6-tetrakis(2-methoxyphenyl)-4-methylbenzene |
|---|---|
| PubChem CID | 145152049 |
| Molecular Formula | C35H31IO4 |
| Molecular Weight | 642.53 g/mol |
| Exact Mass | 642.13 |
| IUPAC Name | 1-iodo-2,3,5,6-tetrakis(2-methoxyphenyl)-4-methylbenzene |
| SMILES | COc1ccccc1-c1c(C)c(-c2ccccc2OC)c(-c2ccccc2OC)c(I)c1-c1ccccc1OC |
| InChI | InChI=1S/C35H31IO4/c1-22-31(23-14-6-10-18-27(23)37-2)33(25-16-8-12-20-29(25)39-4)35(36)34(26-17-9-13-21-30(26)40-5)32(22)24-15-7-11-19-28(24)38-3/h6-21H,1-5H3 |
| InChIKey | IGMHPHZPUDLKFK-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.53 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|