C14H11F2NOS — CID 175606865
1,3-difluoro-2-(2-methoxyphenyl)benzene;isothiocyanic acid (PubChem CID 175606865) has the molecular formula C14H11F2NOS and a molecular weight of 279.31 g/mol. Its IUPAC name is 1,3-difluoro-2-(2-methoxyphenyl)benzene;isothiocyanic acid.
| Compound Name | 1,3-difluoro-2-(2-methoxyphenyl)benzene;isothiocyanic acid |
|---|---|
| PubChem CID | 175606865 |
| Molecular Formula | C14H11F2NOS |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 1,3-difluoro-2-(2-methoxyphenyl)benzene;isothiocyanic acid |
| SMILES | COc1ccccc1-c1c(F)cccc1F.N=C=S |
| InChI | InChI=1S/C13H10F2O.CHNS/c1-16-12-8-3-2-5-9(12)13-10(14)6-4-7-11(13)15;2-1-3/h2-8H,1H3;2H |
| InChIKey | BJONTLADTWDPQY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|