1,3-difluoro-2-(2-methoxyphenyl)benzene;isothiocyanic acid

C14H11F2NOS — CID 175606865

IUPAC1,3-difluoro-2-(2-methoxyphenyl)benzene;isothiocyanic acid
SMILESCOc1ccccc1-c1c(F)cccc1F.N=C=S
InChIInChI=1S/C13H10F2O.CHNS/c1-16-12-8-3-2-5-9(12)13-10(14)6-4-7-11(13)15;2-1-3/h2-8H,1H3;2H
InChIKeyBJONTLADTWDPQY-UHFFFAOYSA-N
MW279.31 g/mol
LogP4.31
Rot. Bonds2

About 1,3-difluoro-2-(2-methoxyphenyl)benzene;isothiocyanic acid

1,3-difluoro-2-(2-methoxyphenyl)benzene;isothiocyanic acid (PubChem CID 175606865) has the molecular formula C14H11F2NOS and a molecular weight of 279.31 g/mol. Its IUPAC name is 1,3-difluoro-2-(2-methoxyphenyl)benzene;isothiocyanic acid.

Molecular Properties

Compound Name1,3-difluoro-2-(2-methoxyphenyl)benzene;isothiocyanic acid
PubChem CID175606865
Molecular FormulaC14H11F2NOS
Molecular Weight279.31 g/mol
Exact Mass279.05
IUPAC Name1,3-difluoro-2-(2-methoxyphenyl)benzene;isothiocyanic acid
SMILESCOc1ccccc1-c1c(F)cccc1F.N=C=S
InChIInChI=1S/C13H10F2O.CHNS/c1-16-12-8-3-2-5-9(12)13-10(14)6-4-7-11(13)15;2-1-3/h2-8H,1H3;2H
InChIKeyBJONTLADTWDPQY-UHFFFAOYSA-N
XLogP4.31
TPSA33.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.31
LogP ≤ 54.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}

Analyze 1,3-difluoro-2-(2-methoxyphenyl)benzene;isothiocyanic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-difluoro-2-(2-methoxyphenyl)benzene;isothiocyanic acid?
The IUPAC name of 1,3-difluoro-2-(2-methoxyphenyl)benzene;isothiocyanic acid (CID 175606865) is 1,3-difluoro-2-(2-methoxyphenyl)benzene;isothiocyanic acid.
What is the SMILES notation for 1,3-difluoro-2-(2-methoxyphenyl)benzene;isothiocyanic acid?
The canonical SMILES for 1,3-difluoro-2-(2-methoxyphenyl)benzene;isothiocyanic acid is COc1ccccc1-c1c(F)cccc1F.N=C=S.
What is the InChIKey of 1,3-difluoro-2-(2-methoxyphenyl)benzene;isothiocyanic acid?
The InChIKey is BJONTLADTWDPQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F2O.CHNS/c1-16-12-8-3-2-5-9(12)13-10(14)6-4-7-11(13)15;2-1-3/h2-8H,1H3;2H.
What are the key properties of 1,3-difluoro-2-(2-methoxyphenyl)benzene;isothiocyanic acid?
1,3-difluoro-2-(2-methoxyphenyl)benzene;isothiocyanic acid has a molecular weight of 279.31 g/mol, XLogP of 4.31, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-difluoro-2-(2-methoxyphenyl)benzene;isothiocyanic acid is sourced from PubChem (CID 175606865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).