C14H14FNO2 — CID 107602899
2-(2,6-dimethoxyphenyl)-6-fluoroaniline (PubChem CID 107602899) has the molecular formula C14H14FNO2 and a molecular weight of 247.27 g/mol. Its IUPAC name is 2-(2,6-dimethoxyphenyl)-6-fluoroaniline.
| Compound Name | 2-(2,6-dimethoxyphenyl)-6-fluoroaniline |
|---|---|
| PubChem CID | 107602899 |
| Molecular Formula | C14H14FNO2 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-(2,6-dimethoxyphenyl)-6-fluoroaniline |
| SMILES | COc1cccc(OC)c1-c1cccc(F)c1N |
| InChI | InChI=1S/C14H14FNO2/c1-17-11-7-4-8-12(18-2)13(11)9-5-3-6-10(15)14(9)16/h3-8H,16H2,1-2H3 |
| InChIKey | ZVDGFZCWBHGLBV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|