C15H13FO3 — CID 116810904
4-(2,6-dimethoxyphenyl)-3-fluorobenzaldehyde (PubChem CID 116810904) has the molecular formula C15H13FO3 and a molecular weight of 260.26 g/mol. Its IUPAC name is 4-(2,6-dimethoxyphenyl)-3-fluorobenzaldehyde.
| Compound Name | 4-(2,6-dimethoxyphenyl)-3-fluorobenzaldehyde |
|---|---|
| PubChem CID | 116810904 |
| Molecular Formula | C15H13FO3 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 4-(2,6-dimethoxyphenyl)-3-fluorobenzaldehyde |
| SMILES | COc1cccc(OC)c1-c1ccc(C=O)cc1F |
| InChI | InChI=1S/C15H13FO3/c1-18-13-4-3-5-14(19-2)15(13)11-7-6-10(9-17)8-12(11)16/h3-9H,1-2H3 |
| InChIKey | AFYSENOGJURTQO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|