About 1-methoxy-2-phenylbenzene;2-methylthiophene
1-methoxy-2-phenylbenzene;2-methylthiophene (PubChem CID 174457563) has the molecular formula C18H18OS
and a molecular weight of 282.41 g/mol. Its IUPAC name is 1-methoxy-2-phenylbenzene;2-methylthiophene.
Molecular Properties
| Compound Name | 1-methoxy-2-phenylbenzene;2-methylthiophene |
| PubChem CID | 174457563 |
| Molecular Formula | C18H18OS |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 1-methoxy-2-phenylbenzene;2-methylthiophene |
| SMILES | COc1ccccc1-c1ccccc1.Cc1cccs1 |
| InChI | InChI=1S/C13H12O.C5H6S/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11;1-5-3-2-4-6-5/h2-10H,1H3;2-4H,1H3 |
| InChIKey | HEFFYXZILVASLF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methoxy-2-phenylbenzene;2-methylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2-phenylbenzene;2-methylthiophene?
The IUPAC name of 1-methoxy-2-phenylbenzene;2-methylthiophene (CID 174457563) is 1-methoxy-2-phenylbenzene;2-methylthiophene.
What is the SMILES notation for 1-methoxy-2-phenylbenzene;2-methylthiophene?
The canonical SMILES for 1-methoxy-2-phenylbenzene;2-methylthiophene is COc1ccccc1-c1ccccc1.Cc1cccs1.
What is the InChIKey of 1-methoxy-2-phenylbenzene;2-methylthiophene?
The InChIKey is HEFFYXZILVASLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O.C5H6S/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11;1-5-3-2-4-6-5/h2-10H,1H3;2-4H,1H3.
What are the key properties of 1-methoxy-2-phenylbenzene;2-methylthiophene?
1-methoxy-2-phenylbenzene;2-methylthiophene has a molecular weight of 282.41 g/mol, XLogP of 5.42, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2-phenylbenzene;2-methylthiophene is sourced from PubChem (CID 174457563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).