C45H50I2O2 — CID 166514580
2,4-diiodo-1,5-bis[3-(2-methoxyphenyl)-2,6-di(propan-2-yl)phenyl]-3-methylbenzene (PubChem CID 166514580) has the molecular formula C45H50I2O2 and a molecular weight of 876.70 g/mol. Its IUPAC name is 2,4-diiodo-1,5-bis[3-(2-methoxyphenyl)-2,6-di(propan-2-yl)phenyl]-3-methylbenzene.
| Compound Name | 2,4-diiodo-1,5-bis[3-(2-methoxyphenyl)-2,6-di(propan-2-yl)phenyl]-3-methylbenzene |
|---|---|
| PubChem CID | 166514580 |
| Molecular Formula | C45H50I2O2 |
| Molecular Weight | 876.70 g/mol |
| Exact Mass | 876.19 |
| IUPAC Name | 2,4-diiodo-1,5-bis[3-(2-methoxyphenyl)-2,6-di(propan-2-yl)phenyl]-3-methylbenzene |
| SMILES | COc1ccccc1-c1ccc(C(C)C)c(-c2cc(-c3c(C(C)C)ccc(-c4ccccc4OC)c3C(C)C)c(I)c(C)c2I)c1C(C)C |
| InChI | InChI=1S/C45H50I2O2/c1-25(2)30-20-22-34(32-16-12-14-18-38(32)48-10)40(27(5)6)42(30)36-24-37(45(47)29(9)44(36)46)43-31(26(3)4)21-23-35(41(43)28(7)8)33-17-13-15-19-39(33)49-11/h12-28H,1-11H3 |
| InChIKey | NCRBKACBERMZMH-UHFFFAOYSA-N |
| XLogP | 14.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.70 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|