C38H51O2P — CID 175808760
[3,5-bis(2-methoxyphenyl)-2,6-di(propan-2-yl)phenyl]-dicyclohexylphosphane (PubChem CID 175808760) has the molecular formula C38H51O2P and a molecular weight of 570.80 g/mol. Its IUPAC name is [3,5-bis(2-methoxyphenyl)-2,6-di(propan-2-yl)phenyl]-dicyclohexylphosphane.
| Compound Name | [3,5-bis(2-methoxyphenyl)-2,6-di(propan-2-yl)phenyl]-dicyclohexylphosphane |
|---|---|
| PubChem CID | 175808760 |
| Molecular Formula | C38H51O2P |
| Molecular Weight | 570.80 g/mol |
| Exact Mass | 570.36 |
| IUPAC Name | [3,5-bis(2-methoxyphenyl)-2,6-di(propan-2-yl)phenyl]-dicyclohexylphosphane |
| SMILES | COc1ccccc1-c1cc(-c2ccccc2OC)c(C(C)C)c(P(C2CCCCC2)C2CCCCC2)c1C(C)C |
| InChI | InChI=1S/C38H51O2P/c1-26(2)36-32(30-21-13-15-23-34(30)39-5)25-33(31-22-14-16-24-35(31)40-6)37(27(3)4)38(36)41(28-17-9-7-10-18-28)29-19-11-8-12-20-29/h13-16,21-29H,7-12,17-20H2,1-6H3 |
| InChIKey | DYBLACGCACONIG-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.80 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|