C77H94O5P2 — CID 166514583
dicyclohexyl-[3-dicyclohexylphosphanyl-4,6-bis[2,6-dimethoxy-3,5-bis(2-methylphenyl)phenyl]-2-propan-2-yloxyphenyl]phosphane (PubChem CID 166514583) has the molecular formula C77H94O5P2 and a molecular weight of 1161.54 g/mol. Its IUPAC name is dicyclohexyl-[3-dicyclohexylphosphanyl-4,6-bis[2,6-dimethoxy-3,5-bis(2-methylphenyl)phenyl]-2-propan-2-yloxyphenyl]phosphane.
| Compound Name | dicyclohexyl-[3-dicyclohexylphosphanyl-4,6-bis[2,6-dimethoxy-3,5-bis(2-methylphenyl)phenyl]-2-propan-2-yloxyphenyl]phosphane |
|---|---|
| PubChem CID | 166514583 |
| Molecular Formula | C77H94O5P2 |
| Molecular Weight | 1161.54 g/mol |
| Exact Mass | 1160.66 |
| IUPAC Name | dicyclohexyl-[3-dicyclohexylphosphanyl-4,6-bis[2,6-dimethoxy-3,5-bis(2-methylphenyl)phenyl]-2-propan-2-yloxyphenyl]phosphane |
| SMILES | COc1c(-c2ccccc2C)cc(-c2ccccc2C)c(OC)c1-c1cc(-c2c(OC)c(-c3ccccc3C)cc(-c3ccccc3C)c2OC)c(P(C2CCCCC2)C2CCCCC2)c(OC(C)C)c1P(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C77H94O5P2/c1-50(2)82-75-76(83(55-35-15-11-16-36-55)56-37-17-12-18-38-56)67(69-71(78-7)63(59-43-27-23-31-51(59)3)47-64(72(69)79-8)60-44-28-24-32-52(60)4)49-68(77(75)84(57-39-19-13-20-40-57)58-41-21-14-22-42-58)70-73(80-9)65(61-45-29-25-33-53(61)5)48-66(74(70)81-10)62-46-30-26-34-54(62)6/h23-34,43-50,55-58H,11-22,35-42H2,1-10H3 |
| InChIKey | CJJGSUDSCUCYOU-UHFFFAOYSA-N |
| XLogP | 21.29 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1161.54 |
| LogP ≤ 5 | 21.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|