C64H84IO2P — CID 159939308
ditert-butyl-[2-methoxy-6-[3-phenyl-2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane;2-(2-iodo-3-methoxyphenyl)-4-phenyl-1,3,5-tri(propan-2-yl)benzene (PubChem CID 159939308) has the molecular formula C64H84IO2P and a molecular weight of 1043.25 g/mol. Its IUPAC name is ditert-butyl-[2-methoxy-6-[3-phenyl-2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane;2-(2-iodo-3-methoxyphenyl)-4-phenyl-1,3,5-tri(propan-2-yl)benzene.
| Compound Name | ditert-butyl-[2-methoxy-6-[3-phenyl-2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane;2-(2-iodo-3-methoxyphenyl)-4-phenyl-1,3,5-tri(propan-2-yl)benzene |
|---|---|
| PubChem CID | 159939308 |
| Molecular Formula | C64H84IO2P |
| Molecular Weight | 1043.25 g/mol |
| Exact Mass | 1042.53 |
| IUPAC Name | ditert-butyl-[2-methoxy-6-[3-phenyl-2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane;2-(2-iodo-3-methoxyphenyl)-4-phenyl-1,3,5-tri(propan-2-yl)benzene |
| SMILES | COc1cccc(-c2c(C(C)C)cc(C(C)C)c(-c3ccccc3)c2C(C)C)c1I.COc1cccc(-c2c(C(C)C)cc(C(C)C)c(-c3ccccc3)c2C(C)C)c1P(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C36H51OP.C28H33IO/c1-23(2)28-22-29(24(3)4)33(31(25(5)6)32(28)26-18-15-14-16-19-26)27-20-17-21-30(37-13)34(27)38(35(7,8)9)36(10,11)12;1-17(2)22-16-23(18(3)4)27(21-14-11-15-24(30-7)28(21)29)25(19(5)6)26(22)20-12-9-8-10-13-20/h14-25H,1-13H3;8-19H,1-7H3 |
| InChIKey | OARAOFVOHJSYIW-UHFFFAOYSA-N |
| XLogP | 20.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1043.25 |
| LogP ≤ 5 | 20.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|