C29H37O3P — CID 121483097
ditert-butyl-[2-(2,4,6-trimethoxy-3-phenylphenyl)phenyl]phosphane (PubChem CID 121483097) has the molecular formula C29H37O3P and a molecular weight of 464.59 g/mol. Its IUPAC name is ditert-butyl-[2-(2,4,6-trimethoxy-3-phenylphenyl)phenyl]phosphane.
| Compound Name | ditert-butyl-[2-(2,4,6-trimethoxy-3-phenylphenyl)phenyl]phosphane |
|---|---|
| PubChem CID | 121483097 |
| Molecular Formula | C29H37O3P |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | ditert-butyl-[2-(2,4,6-trimethoxy-3-phenylphenyl)phenyl]phosphane |
| SMILES | COc1cc(OC)c(-c2ccccc2P(C(C)(C)C)C(C)(C)C)c(OC)c1-c1ccccc1 |
| InChI | InChI=1S/C29H37O3P/c1-28(2,3)33(29(4,5)6)24-18-14-13-17-21(24)26-23(31-8)19-22(30-7)25(27(26)32-9)20-15-11-10-12-16-20/h10-19H,1-9H3 |
| InChIKey | ANXPGRBTDFGANU-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|