C16H27O2PPd — CID 175742827
ditert-butyl-(2,3-dimethoxyphenyl)phosphane;palladium (PubChem CID 175742827) has the molecular formula C16H27O2PPd and a molecular weight of 388.78 g/mol. Its IUPAC name is ditert-butyl-(2,3-dimethoxyphenyl)phosphane;palladium.
| Compound Name | ditert-butyl-(2,3-dimethoxyphenyl)phosphane;palladium |
|---|---|
| PubChem CID | 175742827 |
| Molecular Formula | C16H27O2PPd |
| Molecular Weight | 388.78 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | ditert-butyl-(2,3-dimethoxyphenyl)phosphane;palladium |
| SMILES | COc1cccc(P(C(C)(C)C)C(C)(C)C)c1OC.[Pd] |
| InChI | InChI=1S/C16H27O2P.Pd/c1-15(2,3)19(16(4,5)6)13-11-9-10-12(17-7)14(13)18-8;/h9-11H,1-8H3; |
| InChIKey | QKASYAMQKZRGRS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.78 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|