About ditert-butyl-(2,3-dimethoxyphenyl)phosphane;palladium
ditert-butyl-(2,3-dimethoxyphenyl)phosphane;palladium (PubChem CID 175742827) has the molecular formula C16H27O2PPd
and a molecular weight of 388.78 g/mol. Its IUPAC name is ditert-butyl-(2,3-dimethoxyphenyl)phosphane;palladium.
Molecular Properties
| Compound Name | ditert-butyl-(2,3-dimethoxyphenyl)phosphane;palladium |
| PubChem CID | 175742827 |
| Molecular Formula | C16H27O2PPd |
| Molecular Weight | 388.78 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | ditert-butyl-(2,3-dimethoxyphenyl)phosphane;palladium |
| SMILES | COc1cccc(P(C(C)(C)C)C(C)(C)C)c1OC.[Pd] |
| InChI | InChI=1S/C16H27O2P.Pd/c1-15(2,3)19(16(4,5)6)13-11-9-10-12(17-7)14(13)18-8;/h9-11H,1-8H3; |
| InChIKey | QKASYAMQKZRGRS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.78 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl-(2,3-dimethoxyphenyl)phosphane;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl-(2,3-dimethoxyphenyl)phosphane;palladium?
The IUPAC name of ditert-butyl-(2,3-dimethoxyphenyl)phosphane;palladium (CID 175742827) is ditert-butyl-(2,3-dimethoxyphenyl)phosphane;palladium.
What is the SMILES notation for ditert-butyl-(2,3-dimethoxyphenyl)phosphane;palladium?
The canonical SMILES for ditert-butyl-(2,3-dimethoxyphenyl)phosphane;palladium is COc1cccc(P(C(C)(C)C)C(C)(C)C)c1OC.[Pd].
What is the InChIKey of ditert-butyl-(2,3-dimethoxyphenyl)phosphane;palladium?
The InChIKey is QKASYAMQKZRGRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27O2P.Pd/c1-15(2,3)19(16(4,5)6)13-11-9-10-12(17-7)14(13)18-8;/h9-11H,1-8H3;.
What are the key properties of ditert-butyl-(2,3-dimethoxyphenyl)phosphane;palladium?
ditert-butyl-(2,3-dimethoxyphenyl)phosphane;palladium has a molecular weight of 388.78 g/mol, XLogP of 4.41, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl-(2,3-dimethoxyphenyl)phosphane;palladium is sourced from PubChem (CID 175742827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).