C26H39O2P — CID 153323041
ditert-butyl-[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane (PubChem CID 153323041) has the molecular formula C26H39O2P and a molecular weight of 414.57 g/mol. Its IUPAC name is ditert-butyl-[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane.
| Compound Name | ditert-butyl-[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane |
|---|---|
| PubChem CID | 153323041 |
| Molecular Formula | C26H39O2P |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | ditert-butyl-[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane |
| SMILES | CC(C)Oc1cccc(OC(C)C)c1-c1ccccc1P(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C26H39O2P/c1-18(2)27-21-15-13-16-22(28-19(3)4)24(21)20-14-11-12-17-23(20)29(25(5,6)7)26(8,9)10/h11-19H,1-10H3 |
| InChIKey | BKRNYRUHEJMAMI-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|