C32H47O2P — CID 142281030
ditert-butyl-[2-(2,6-dicyclohexyloxyphenyl)phenyl]phosphane (PubChem CID 142281030) has the molecular formula C32H47O2P and a molecular weight of 494.70 g/mol. Its IUPAC name is ditert-butyl-[2-(2,6-dicyclohexyloxyphenyl)phenyl]phosphane.
| Compound Name | ditert-butyl-[2-(2,6-dicyclohexyloxyphenyl)phenyl]phosphane |
|---|---|
| PubChem CID | 142281030 |
| Molecular Formula | C32H47O2P |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.33 |
| IUPAC Name | ditert-butyl-[2-(2,6-dicyclohexyloxyphenyl)phenyl]phosphane |
| SMILES | CC(C)(C)P(c1ccccc1-c1c(OC2CCCCC2)cccc1OC1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C32H47O2P/c1-31(2,3)35(32(4,5)6)29-23-14-13-20-26(29)30-27(33-24-16-9-7-10-17-24)21-15-22-28(30)34-25-18-11-8-12-19-25/h13-15,20-25H,7-12,16-19H2,1-6H3 |
| InChIKey | NCYJAQBDJOTHCT-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|