About 2-cyclohexyloxybenzenethiol;fluoroform
2-cyclohexyloxybenzenethiol;fluoroform (PubChem CID 174582478) has the molecular formula C13H17F3OS
and a molecular weight of 278.34 g/mol. Its IUPAC name is 2-cyclohexyloxybenzenethiol;fluoroform.
Molecular Properties
| Compound Name | 2-cyclohexyloxybenzenethiol;fluoroform |
| PubChem CID | 174582478 |
| Molecular Formula | C13H17F3OS |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 2-cyclohexyloxybenzenethiol;fluoroform |
| SMILES | FC(F)F.Sc1ccccc1OC1CCCCC1 |
| InChI | InChI=1S/C12H16OS.CHF3/c14-12-9-5-4-8-11(12)13-10-6-2-1-3-7-10;2-1(3)4/h4-5,8-10,14H,1-3,6-7H2;1H |
| InChIKey | DKGZGFUGNRIWMO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyloxybenzenethiol;fluoroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyloxybenzenethiol;fluoroform?
The IUPAC name of 2-cyclohexyloxybenzenethiol;fluoroform (CID 174582478) is 2-cyclohexyloxybenzenethiol;fluoroform.
What is the SMILES notation for 2-cyclohexyloxybenzenethiol;fluoroform?
The canonical SMILES for 2-cyclohexyloxybenzenethiol;fluoroform is FC(F)F.Sc1ccccc1OC1CCCCC1.
What is the InChIKey of 2-cyclohexyloxybenzenethiol;fluoroform?
The InChIKey is DKGZGFUGNRIWMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16OS.CHF3/c14-12-9-5-4-8-11(12)13-10-6-2-1-3-7-10;2-1(3)4/h4-5,8-10,14H,1-3,6-7H2;1H.
What are the key properties of 2-cyclohexyloxybenzenethiol;fluoroform?
2-cyclohexyloxybenzenethiol;fluoroform has a molecular weight of 278.34 g/mol, XLogP of 4.87, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyloxybenzenethiol;fluoroform is sourced from PubChem (CID 174582478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).