C40H57O4P — CID 170566802
[2,6-bis[2,6-di(propan-2-yloxy)phenyl]phenyl]-tert-butyl-cyclohexylphosphane (PubChem CID 170566802) has the molecular formula C40H57O4P and a molecular weight of 632.87 g/mol. Its IUPAC name is [2,6-bis[2,6-di(propan-2-yloxy)phenyl]phenyl]-tert-butyl-cyclohexylphosphane.
| Compound Name | [2,6-bis[2,6-di(propan-2-yloxy)phenyl]phenyl]-tert-butyl-cyclohexylphosphane |
|---|---|
| PubChem CID | 170566802 |
| Molecular Formula | C40H57O4P |
| Molecular Weight | 632.87 g/mol |
| Exact Mass | 632.40 |
| IUPAC Name | [2,6-bis[2,6-di(propan-2-yloxy)phenyl]phenyl]-tert-butyl-cyclohexylphosphane |
| SMILES | CC(C)Oc1cccc(OC(C)C)c1-c1cccc(-c2c(OC(C)C)cccc2OC(C)C)c1P(C1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C40H57O4P/c1-26(2)41-33-22-16-23-34(42-27(3)4)37(33)31-20-15-21-32(39(31)45(40(9,10)11)30-18-13-12-14-19-30)38-35(43-28(5)6)24-17-25-36(38)44-29(7)8/h15-17,20-30H,12-14,18-19H2,1-11H3 |
| InChIKey | XKDLXFFGUJBHRL-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.87 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|