C42H54NO2PPd — CID 169044953
dicyclohexyl-[2-[2,6-di(propan-2-yloxy)phenyl]benzene-6-id-1-yl]phosphane;palladium(2+);2-phenylcyclohexa-2,4-dien-1-amine (PubChem CID 169044953) has the molecular formula C42H54NO2PPd and a molecular weight of 742.29 g/mol. Its IUPAC name is dicyclohexyl-[2-[2,6-di(propan-2-yloxy)phenyl]benzene-6-id-1-yl]phosphane;palladium(2+);2-phenylcyclohexa-2,4-dien-1-amine.
| Compound Name | dicyclohexyl-[2-[2,6-di(propan-2-yloxy)phenyl]benzene-6-id-1-yl]phosphane;palladium(2+);2-phenylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 169044953 |
| Molecular Formula | C42H54NO2PPd |
| Molecular Weight | 742.29 g/mol |
| Exact Mass | 741.29 |
| IUPAC Name | dicyclohexyl-[2-[2,6-di(propan-2-yloxy)phenyl]benzene-6-id-1-yl]phosphane;palladium(2+);2-phenylcyclohexa-2,4-dien-1-amine |
| SMILES | CC(C)Oc1cccc(OC(C)C)c1-c1ccc[c-]c1P(C1CCCCC1)C1CCCCC1.N[C-]1CC=CC=C1c1ccccc1.[Pd+2] |
| InChI | InChI=1S/C30H42O2P.C12H12N.Pd/c1-22(2)31-27-19-13-20-28(32-23(3)4)30(27)26-18-11-12-21-29(26)33(24-14-7-5-8-15-24)25-16-9-6-10-17-25;13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h11-13,18-20,22-25H,5-10,14-17H2,1-4H3;1-8H,9,13H2;/q2*-1;+2 |
| InChIKey | DBYQMNKUEYVSCJ-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.29 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|