C35H47OPPd+2 — CID 160619038
dicyclohexyl-[2-(2-methyl-6-propan-2-yloxyphenyl)phenyl]phosphanium;methylbenzene;palladium(2+) (PubChem CID 160619038) has the molecular formula C35H47OPPd+2 and a molecular weight of 621.15 g/mol. Its IUPAC name is dicyclohexyl-[2-(2-methyl-6-propan-2-yloxyphenyl)phenyl]phosphanium;methylbenzene;palladium(2+).
| Compound Name | dicyclohexyl-[2-(2-methyl-6-propan-2-yloxyphenyl)phenyl]phosphanium;methylbenzene;palladium(2+) |
|---|---|
| PubChem CID | 160619038 |
| Molecular Formula | C35H47OPPd+2 |
| Molecular Weight | 621.15 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | dicyclohexyl-[2-(2-methyl-6-propan-2-yloxyphenyl)phenyl]phosphanium;methylbenzene;palladium(2+) |
| SMILES | Cc1cc[c-]cc1.Cc1cccc(OC(C)C)c1-c1ccccc1[PH+](C1CCCCC1)C1CCCCC1.[Pd+2] |
| InChI | InChI=1S/C28H39OP.C7H7.Pd/c1-21(2)29-26-19-12-13-22(3)28(26)25-18-10-11-20-27(25)30(23-14-6-4-7-15-23)24-16-8-5-9-17-24;1-7-5-3-2-4-6-7;/h10-13,18-21,23-24H,4-9,14-17H2,1-3H3;3-6H,1H3;/q;-1;+2/p+1 |
| InChIKey | QXFTYGDGVBZLTN-UHFFFAOYSA-O |
| XLogP | 9.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.15 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|