C37H53O2P — CID 121483098
ditert-butyl-[3,6-dimethoxy-2-[3-phenyl-2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane (PubChem CID 121483098) has the molecular formula C37H53O2P and a molecular weight of 560.80 g/mol. Its IUPAC name is ditert-butyl-[3,6-dimethoxy-2-[3-phenyl-2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane.
| Compound Name | ditert-butyl-[3,6-dimethoxy-2-[3-phenyl-2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane |
|---|---|
| PubChem CID | 121483098 |
| Molecular Formula | C37H53O2P |
| Molecular Weight | 560.80 g/mol |
| Exact Mass | 560.38 |
| IUPAC Name | ditert-butyl-[3,6-dimethoxy-2-[3-phenyl-2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane |
| SMILES | COc1ccc(OC)c(P(C(C)(C)C)C(C)(C)C)c1-c1c(C(C)C)cc(C(C)C)c(-c2ccccc2)c1C(C)C |
| InChI | InChI=1S/C37H53O2P/c1-23(2)27-22-28(24(3)4)33(31(25(5)6)32(27)26-18-16-15-17-19-26)34-29(38-13)20-21-30(39-14)35(34)40(36(7,8)9)37(10,11)12/h15-25H,1-14H3 |
| InChIKey | ILEADOISRJXMHM-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.80 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|