C35H41O2P — CID 102481833
[3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-diphenylphosphane (PubChem CID 102481833) has the molecular formula C35H41O2P and a molecular weight of 524.69 g/mol. Its IUPAC name is [3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-diphenylphosphane.
| Compound Name | [3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 102481833 |
| Molecular Formula | C35H41O2P |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | [3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-diphenylphosphane |
| SMILES | COc1ccc(OC)c(P(c2ccccc2)c2ccccc2)c1-c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C35H41O2P/c1-23(2)26-21-29(24(3)4)33(30(22-26)25(5)6)34-31(36-7)19-20-32(37-8)35(34)38(27-15-11-9-12-16-27)28-17-13-10-14-18-28/h9-25H,1-8H3 |
| InChIKey | PDUUCWXWEKGJCF-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|