C31H39N2OP — CID 58112654
[6-methoxy-3-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-di(pyrrol-1-yl)phosphane (PubChem CID 58112654) has the molecular formula C31H39N2OP and a molecular weight of 486.64 g/mol. Its IUPAC name is [6-methoxy-3-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-di(pyrrol-1-yl)phosphane.
| Compound Name | [6-methoxy-3-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-di(pyrrol-1-yl)phosphane |
|---|---|
| PubChem CID | 58112654 |
| Molecular Formula | C31H39N2OP |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | [6-methoxy-3-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-di(pyrrol-1-yl)phosphane |
| SMILES | COc1ccc(C)c(-c2c(C(C)C)cc(C(C)C)cc2C(C)C)c1P(n1cccc1)n1cccc1 |
| InChI | InChI=1S/C31H39N2OP/c1-21(2)25-19-26(22(3)4)30(27(20-25)23(5)6)29-24(7)13-14-28(34-8)31(29)35(32-15-9-10-16-32)33-17-11-12-18-33/h9-23H,1-8H3 |
| InChIKey | VXCTYJGWLHVCKT-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 19.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|