C31H49O2P — CID 135193691
[3-ditert-butylphosphanyl-4-methoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]methanol (PubChem CID 135193691) has the molecular formula C31H49O2P and a molecular weight of 484.71 g/mol. Its IUPAC name is [3-ditert-butylphosphanyl-4-methoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]methanol.
| Compound Name | [3-ditert-butylphosphanyl-4-methoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]methanol |
|---|---|
| PubChem CID | 135193691 |
| Molecular Formula | C31H49O2P |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.35 |
| IUPAC Name | [3-ditert-butylphosphanyl-4-methoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]methanol |
| SMILES | COc1ccc(CO)c(-c2c(C(C)C)cc(C(C)C)cc2C(C)C)c1P(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C31H49O2P/c1-19(2)23-16-24(20(3)4)28(25(17-23)21(5)6)27-22(18-32)14-15-26(33-13)29(27)34(30(7,8)9)31(10,11)12/h14-17,19-21,32H,18H2,1-13H3 |
| InChIKey | LUBXJZGVWJAYSO-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|