C27H41O2P — CID 90042340
butyl-[3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane (PubChem CID 90042340) has the molecular formula C27H41O2P and a molecular weight of 428.60 g/mol. Its IUPAC name is butyl-[3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane.
| Compound Name | butyl-[3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane |
|---|---|
| PubChem CID | 90042340 |
| Molecular Formula | C27H41O2P |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | butyl-[3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane |
| SMILES | CCCCPc1c(OC)ccc(OC)c1-c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C27H41O2P/c1-10-11-14-30-27-24(29-9)13-12-23(28-8)26(27)25-21(18(4)5)15-20(17(2)3)16-22(25)19(6)7/h12-13,15-19,30H,10-11,14H2,1-9H3 |
| InChIKey | AFEQOYSCOYYMQS-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|