C20H36Cl2N2O — CID 171308476
1-[(1R)-1-(2-methoxy-5-propan-2-ylphenyl)hexyl]piperazine;dihydrochloride (PubChem CID 171308476) has the molecular formula C20H36Cl2N2O and a molecular weight of 391.43 g/mol. Its IUPAC name is 1-[(1R)-1-(2-methoxy-5-propan-2-ylphenyl)hexyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(2-methoxy-5-propan-2-ylphenyl)hexyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171308476 |
| Molecular Formula | C20H36Cl2N2O |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 1-[(1R)-1-(2-methoxy-5-propan-2-ylphenyl)hexyl]piperazine;dihydrochloride |
| SMILES | CCCCC[C@H](c1cc(C(C)C)ccc1OC)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C20H34N2O.2ClH/c1-5-6-7-8-19(22-13-11-21-12-14-22)18-15-17(16(2)3)9-10-20(18)23-4;;/h9-10,15-16,19,21H,5-8,11-14H2,1-4H3;2*1H/t19-;;/m1../s1 |
| InChIKey | GRTDURSMFWLMQZ-JQDLGSOUSA-N |
| XLogP | 5.19 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|