C18H30N2O3 — CID 171307378
1-[(1R)-1-(2,4,5-trimethoxyphenyl)pentyl]piperazine (PubChem CID 171307378) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-[(1R)-1-(2,4,5-trimethoxyphenyl)pentyl]piperazine.
| Compound Name | 1-[(1R)-1-(2,4,5-trimethoxyphenyl)pentyl]piperazine |
|---|---|
| PubChem CID | 171307378 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 1-[(1R)-1-(2,4,5-trimethoxyphenyl)pentyl]piperazine |
| SMILES | CCCC[C@H](c1cc(OC)c(OC)cc1OC)N1CCNCC1 |
| InChI | InChI=1S/C18H30N2O3/c1-5-6-7-15(20-10-8-19-9-11-20)14-12-17(22-3)18(23-4)13-16(14)21-2/h12-13,15,19H,5-11H2,1-4H3/t15-/m1/s1 |
| InChIKey | QLWUCMDMJILQKG-OAHLLOKOSA-N |
| XLogP | 2.85 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |