C15H25Cl2FN2O3 — CID 171273557
1-[(1R)-2-fluoro-1-(2,4,5-trimethoxyphenyl)ethyl]piperazine;dihydrochloride (PubChem CID 171273557) has the molecular formula C15H25Cl2FN2O3 and a molecular weight of 371.28 g/mol. Its IUPAC name is 1-[(1R)-2-fluoro-1-(2,4,5-trimethoxyphenyl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-2-fluoro-1-(2,4,5-trimethoxyphenyl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171273557 |
| Molecular Formula | C15H25Cl2FN2O3 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 1-[(1R)-2-fluoro-1-(2,4,5-trimethoxyphenyl)ethyl]piperazine;dihydrochloride |
| SMILES | COc1cc(OC)c([C@H](CF)N2CCNCC2)cc1OC.Cl.Cl |
| InChI | InChI=1S/C15H23FN2O3.2ClH/c1-19-13-9-15(21-3)14(20-2)8-11(13)12(10-16)18-6-4-17-5-7-18;;/h8-9,12,17H,4-7,10H2,1-3H3;2*1H/t12-;;/m0../s1 |
| InChIKey | OUSLBJSYDHOPOG-LTCKWSDVSA-N |
| XLogP | 2.47 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |