C14H23Cl2FN2O2 — CID 171274756
1-[(1R)-1-(2,4-dimethoxyphenyl)-2-fluoroethyl]piperazine;dihydrochloride (PubChem CID 171274756) has the molecular formula C14H23Cl2FN2O2 and a molecular weight of 341.25 g/mol. Its IUPAC name is 1-[(1R)-1-(2,4-dimethoxyphenyl)-2-fluoroethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(2,4-dimethoxyphenyl)-2-fluoroethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171274756 |
| Molecular Formula | C14H23Cl2FN2O2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 1-[(1R)-1-(2,4-dimethoxyphenyl)-2-fluoroethyl]piperazine;dihydrochloride |
| SMILES | COc1ccc([C@H](CF)N2CCNCC2)c(OC)c1.Cl.Cl |
| InChI | InChI=1S/C14H21FN2O2.2ClH/c1-18-11-3-4-12(14(9-11)19-2)13(10-15)17-7-5-16-6-8-17;;/h3-4,9,13,16H,5-8,10H2,1-2H3;2*1H/t13-;;/m0../s1 |
| InChIKey | NDZSBHUWPUTNFB-GXKRWWSZSA-N |
| XLogP | 2.46 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |