C20H33N3O2 — CID 112539822
1-[1-(2,4-dimethoxyphenyl)-2-(4-methylpiperidin-1-yl)ethyl]piperazine (PubChem CID 112539822) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is 1-[1-(2,4-dimethoxyphenyl)-2-(4-methylpiperidin-1-yl)ethyl]piperazine.
| Compound Name | 1-[1-(2,4-dimethoxyphenyl)-2-(4-methylpiperidin-1-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 112539822 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 1-[1-(2,4-dimethoxyphenyl)-2-(4-methylpiperidin-1-yl)ethyl]piperazine |
| SMILES | COc1ccc(C(CN2CCC(C)CC2)N2CCNCC2)c(OC)c1 |
| InChI | InChI=1S/C20H33N3O2/c1-16-6-10-22(11-7-16)15-19(23-12-8-21-9-13-23)18-5-4-17(24-2)14-20(18)25-3/h4-5,14,16,19,21H,6-13,15H2,1-3H3 |
| InChIKey | CGGXHMTXBOCJHD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |