C13H20ClFN2O — CID 171181752
1-[(1S)-2-fluoro-1-(4-methoxyphenyl)ethyl]piperazine;hydrochloride (PubChem CID 171181752) has the molecular formula C13H20ClFN2O and a molecular weight of 274.77 g/mol. Its IUPAC name is 1-[(1S)-2-fluoro-1-(4-methoxyphenyl)ethyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-2-fluoro-1-(4-methoxyphenyl)ethyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171181752 |
| Molecular Formula | C13H20ClFN2O |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 1-[(1S)-2-fluoro-1-(4-methoxyphenyl)ethyl]piperazine;hydrochloride |
| SMILES | COc1ccc([C@@H](CF)N2CCNCC2)cc1.Cl |
| InChI | InChI=1S/C13H19FN2O.ClH/c1-17-12-4-2-11(3-5-12)13(10-14)16-8-6-15-7-9-16;/h2-5,13,15H,6-10H2,1H3;1H/t13-;/m1./s1 |
| InChIKey | COBYCASPEFOUIN-BTQNPOSSSA-N |
| XLogP | 2.03 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |