C16H23F3N2O3 — CID 171163041
1-[(1S)-3,3,3-trifluoro-1-(2,4,5-trimethoxyphenyl)propyl]piperazine (PubChem CID 171163041) has the molecular formula C16H23F3N2O3 and a molecular weight of 348.37 g/mol. Its IUPAC name is 1-[(1S)-3,3,3-trifluoro-1-(2,4,5-trimethoxyphenyl)propyl]piperazine.
| Compound Name | 1-[(1S)-3,3,3-trifluoro-1-(2,4,5-trimethoxyphenyl)propyl]piperazine |
|---|---|
| PubChem CID | 171163041 |
| Molecular Formula | C16H23F3N2O3 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 1-[(1S)-3,3,3-trifluoro-1-(2,4,5-trimethoxyphenyl)propyl]piperazine |
| SMILES | COc1cc(OC)c([C@H](CC(F)(F)F)N2CCNCC2)cc1OC |
| InChI | InChI=1S/C16H23F3N2O3/c1-22-13-9-15(24-3)14(23-2)8-11(13)12(10-16(17,18)19)21-6-4-20-5-7-21/h8-9,12,20H,4-7,10H2,1-3H3/t12-/m0/s1 |
| InChIKey | QVGSFYQSDBGKNX-LBPRGKRZSA-N |
| XLogP | 2.61 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |