C16H26N2O4 — CID 171189008
(3R)-3-piperazin-1-yl-3-(2,4,5-trimethoxyphenyl)propan-1-ol (PubChem CID 171189008) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is (3R)-3-piperazin-1-yl-3-(2,4,5-trimethoxyphenyl)propan-1-ol.
| Compound Name | (3R)-3-piperazin-1-yl-3-(2,4,5-trimethoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 171189008 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (3R)-3-piperazin-1-yl-3-(2,4,5-trimethoxyphenyl)propan-1-ol |
| SMILES | COc1cc(OC)c([C@@H](CCO)N2CCNCC2)cc1OC |
| InChI | InChI=1S/C16H26N2O4/c1-20-14-11-16(22-3)15(21-2)10-12(14)13(4-9-19)18-7-5-17-6-8-18/h10-11,13,17,19H,4-9H2,1-3H3/t13-/m1/s1 |
| InChIKey | ALCNVYAAHNEMND-CYBMUJFWSA-N |
| XLogP | 1.04 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |