C17H28N2O3 — CID 171309229
3,5-dimethoxy-4-[(1S)-1-piperazin-1-ylpentyl]phenol (PubChem CID 171309229) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 3,5-dimethoxy-4-[(1S)-1-piperazin-1-ylpentyl]phenol.
| Compound Name | 3,5-dimethoxy-4-[(1S)-1-piperazin-1-ylpentyl]phenol |
|---|---|
| PubChem CID | 171309229 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 3,5-dimethoxy-4-[(1S)-1-piperazin-1-ylpentyl]phenol |
| SMILES | CCCC[C@@H](c1c(OC)cc(O)cc1OC)N1CCNCC1 |
| InChI | InChI=1S/C17H28N2O3/c1-4-5-6-14(19-9-7-18-8-10-19)17-15(21-2)11-13(20)12-16(17)22-3/h11-12,14,18,20H,4-10H2,1-3H3/t14-/m0/s1 |
| InChIKey | WWEXWDQNOVYUOS-AWEZNQCLSA-N |
| XLogP | 2.55 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |