C16H24F2N2O — CID 171173037
1-[(1R)-1-(2,6-difluoro-3-methoxyphenyl)pentyl]piperazine (PubChem CID 171173037) has the molecular formula C16H24F2N2O and a molecular weight of 298.38 g/mol. Its IUPAC name is 1-[(1R)-1-(2,6-difluoro-3-methoxyphenyl)pentyl]piperazine.
| Compound Name | 1-[(1R)-1-(2,6-difluoro-3-methoxyphenyl)pentyl]piperazine |
|---|---|
| PubChem CID | 171173037 |
| Molecular Formula | C16H24F2N2O |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 1-[(1R)-1-(2,6-difluoro-3-methoxyphenyl)pentyl]piperazine |
| SMILES | CCCC[C@H](c1c(F)ccc(OC)c1F)N1CCNCC1 |
| InChI | InChI=1S/C16H24F2N2O/c1-3-4-5-13(20-10-8-19-9-11-20)15-12(17)6-7-14(21-2)16(15)18/h6-7,13,19H,3-5,8-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | WJOGOPSZQOGIHZ-CYBMUJFWSA-N |
| XLogP | 3.11 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |