C17H27ClN2O2 — CID 171308877
1-[(1S)-1-(2-chloro-3,4-dimethoxyphenyl)pentyl]piperazine (PubChem CID 171308877) has the molecular formula C17H27ClN2O2 and a molecular weight of 326.87 g/mol. Its IUPAC name is 1-[(1S)-1-(2-chloro-3,4-dimethoxyphenyl)pentyl]piperazine.
| Compound Name | 1-[(1S)-1-(2-chloro-3,4-dimethoxyphenyl)pentyl]piperazine |
|---|---|
| PubChem CID | 171308877 |
| Molecular Formula | C17H27ClN2O2 |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 1-[(1S)-1-(2-chloro-3,4-dimethoxyphenyl)pentyl]piperazine |
| SMILES | CCCC[C@@H](c1ccc(OC)c(OC)c1Cl)N1CCNCC1 |
| InChI | InChI=1S/C17H27ClN2O2/c1-4-5-6-14(20-11-9-19-10-12-20)13-7-8-15(21-2)17(22-3)16(13)18/h7-8,14,19H,4-6,9-12H2,1-3H3/t14-/m0/s1 |
| InChIKey | AGCAZYPYNZWZHS-AWEZNQCLSA-N |
| XLogP | 3.49 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |