C25H37O2P — CID 127262764
[3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-dimethylphosphane (PubChem CID 127262764) has the molecular formula C25H37O2P and a molecular weight of 400.54 g/mol. Its IUPAC name is [3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-dimethylphosphane.
| Compound Name | [3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-dimethylphosphane |
|---|---|
| PubChem CID | 127262764 |
| Molecular Formula | C25H37O2P |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | [3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-dimethylphosphane |
| SMILES | COc1ccc(OC)c(P(C)C)c1-c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C25H37O2P/c1-15(2)18-13-19(16(3)4)23(20(14-18)17(5)6)24-21(26-7)11-12-22(27-8)25(24)28(9)10/h11-17H,1-10H3 |
| InChIKey | DLUYIYUGGDGPDG-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|