C28H43O5P — CID 118584328
diethoxy-[2,3,4-trimethoxy-6-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane (PubChem CID 118584328) has the molecular formula C28H43O5P and a molecular weight of 490.62 g/mol. Its IUPAC name is diethoxy-[2,3,4-trimethoxy-6-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane.
| Compound Name | diethoxy-[2,3,4-trimethoxy-6-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane |
|---|---|
| PubChem CID | 118584328 |
| Molecular Formula | C28H43O5P |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | diethoxy-[2,3,4-trimethoxy-6-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane |
| SMILES | CCOP(OCC)c1c(-c2c(C(C)C)cc(C(C)C)cc2C(C)C)cc(OC)c(OC)c1OC |
| InChI | InChI=1S/C28H43O5P/c1-12-32-34(33-13-2)28-23(16-24(29-9)26(30-10)27(28)31-11)25-21(18(5)6)14-20(17(3)4)15-22(25)19(7)8/h14-19H,12-13H2,1-11H3 |
| InChIKey | DTHKAEDWGUKOIQ-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|