C13H20O2 — CID 144562755
1-ethyl-2,3-dimethoxy-5-propan-2-ylbenzene (PubChem CID 144562755) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-ethyl-2,3-dimethoxy-5-propan-2-ylbenzene.
| Compound Name | 1-ethyl-2,3-dimethoxy-5-propan-2-ylbenzene |
|---|---|
| PubChem CID | 144562755 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 1-ethyl-2,3-dimethoxy-5-propan-2-ylbenzene |
| SMILES | CCc1cc(C(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C13H20O2/c1-6-10-7-11(9(2)3)8-12(14-4)13(10)15-5/h7-9H,6H2,1-5H3 |
| InChIKey | VTZNXXDITFGADK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |