C11H14O3 — CID 88965998
3-ethyl-4,5-dimethoxybenzaldehyde (PubChem CID 88965998) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-ethyl-4,5-dimethoxybenzaldehyde.
| Compound Name | 3-ethyl-4,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 88965998 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 3-ethyl-4,5-dimethoxybenzaldehyde |
| SMILES | CCc1cc(C=O)cc(OC)c1OC |
| InChI | InChI=1S/C11H14O3/c1-4-9-5-8(7-12)6-10(13-2)11(9)14-3/h5-7H,4H2,1-3H3 |
| InChIKey | NSFGTTUWBLIOOT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|