C12H14O4 — CID 169454316
3-(3-hydroxyprop-1-enyl)-4,5-dimethoxybenzaldehyde (PubChem CID 169454316) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is 3-(3-hydroxyprop-1-enyl)-4,5-dimethoxybenzaldehyde.
| Compound Name | 3-(3-hydroxyprop-1-enyl)-4,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 169454316 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 3-(3-hydroxyprop-1-enyl)-4,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(C=O)cc(C=CCO)c1OC |
| InChI | InChI=1S/C12H14O4/c1-15-11-7-9(8-14)6-10(4-3-5-13)12(11)16-2/h3-4,6-8,13H,5H2,1-2H3 |
| InChIKey | YFPJVPCWMVYZJC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|