C10H12F2O3 — CID 84683414
[5-(difluoromethyl)-2,3-dimethoxyphenyl]methanol (PubChem CID 84683414) has the molecular formula C10H12F2O3 and a molecular weight of 218.20 g/mol. Its IUPAC name is [5-(difluoromethyl)-2,3-dimethoxyphenyl]methanol.
| Compound Name | [5-(difluoromethyl)-2,3-dimethoxyphenyl]methanol |
|---|---|
| PubChem CID | 84683414 |
| Molecular Formula | C10H12F2O3 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | [5-(difluoromethyl)-2,3-dimethoxyphenyl]methanol |
| SMILES | COc1cc(C(F)F)cc(CO)c1OC |
| InChI | InChI=1S/C10H12F2O3/c1-14-8-4-6(10(11)12)3-7(5-13)9(8)15-2/h3-4,10,13H,5H2,1-2H3 |
| InChIKey | NYDTXSUCXQTBJN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |