C12H16F2O3 — CID 84705649
2-[5-(difluoromethyl)-2,3-dimethoxyphenyl]propan-2-ol (PubChem CID 84705649) has the molecular formula C12H16F2O3 and a molecular weight of 246.25 g/mol. Its IUPAC name is 2-[5-(difluoromethyl)-2,3-dimethoxyphenyl]propan-2-ol.
| Compound Name | 2-[5-(difluoromethyl)-2,3-dimethoxyphenyl]propan-2-ol |
|---|---|
| PubChem CID | 84705649 |
| Molecular Formula | C12H16F2O3 |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 2-[5-(difluoromethyl)-2,3-dimethoxyphenyl]propan-2-ol |
| SMILES | COc1cc(C(F)F)cc(C(C)(C)O)c1OC |
| InChI | InChI=1S/C12H16F2O3/c1-12(2,15)8-5-7(11(13)14)6-9(16-3)10(8)17-4/h5-6,11,15H,1-4H3 |
| InChIKey | PQPHNJASSNPQNJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |